C22H35ClF2N4O3S — CID 123724056
5-chloro-2-[4-[5-[1-(3,3-difluoropropylsulfonyl)piperidin-4-yl]oxypentan-2-yl]piperidin-1-yl]pyrimidine (PubChem CID 123724056) has the molecular formula C22H35ClF2N4O3S and a molecular weight of 509.06 g/mol. Its IUPAC name is 5-chloro-2-[4-[5-[1-(3,3-difluoropropylsulfonyl)piperidin-4-yl]oxypentan-2-yl]piperidin-1-yl]pyrimidine.
| Compound Name | 5-chloro-2-[4-[5-[1-(3,3-difluoropropylsulfonyl)piperidin-4-yl]oxypentan-2-yl]piperidin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 123724056 |
| Molecular Formula | C22H35ClF2N4O3S |
| Molecular Weight | 509.06 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 5-chloro-2-[4-[5-[1-(3,3-difluoropropylsulfonyl)piperidin-4-yl]oxypentan-2-yl]piperidin-1-yl]pyrimidine |
| SMILES | CC(CCCOC1CCN(S(=O)(=O)CCC(F)F)CC1)C1CCN(c2ncc(Cl)cn2)CC1 |
| InChI | InChI=1S/C22H35ClF2N4O3S/c1-17(18-4-9-28(10-5-18)22-26-15-19(23)16-27-22)3-2-13-32-20-6-11-29(12-7-20)33(30,31)14-8-21(24)25/h15-18,20-21H,2-14H2,1H3 |
| InChIKey | QEKHPLNUWVZWGH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.06 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|