C16H27NO2 — CID 123724222
2-(1-methoxyethenyl)-5,6-dimethyl-3-prop-2-enoxyocta-2,4-dien-1-amine (PubChem CID 123724222) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-(1-methoxyethenyl)-5,6-dimethyl-3-prop-2-enoxyocta-2,4-dien-1-amine.
| Compound Name | 2-(1-methoxyethenyl)-5,6-dimethyl-3-prop-2-enoxyocta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 123724222 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-(1-methoxyethenyl)-5,6-dimethyl-3-prop-2-enoxyocta-2,4-dien-1-amine |
| SMILES | C=CCOC(C=C(C)C(C)CC)=C(CN)C(=C)OC |
| InChI | InChI=1S/C16H27NO2/c1-7-9-19-16(10-13(4)12(3)8-2)15(11-17)14(5)18-6/h7,10,12H,1,5,8-9,11,17H2,2-4,6H3 |
| InChIKey | GRVPSBCUUZAYBR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|