C25H22N4O3 — CID 123724384
5-amino-2-[4-(2-cyanoethyl)-2,6-dimethylphenoxy]-4-(4-isocyanoanilino)benzoic acid (PubChem CID 123724384) has the molecular formula C25H22N4O3 and a molecular weight of 426.48 g/mol. Its IUPAC name is 5-amino-2-[4-(2-cyanoethyl)-2,6-dimethylphenoxy]-4-(4-isocyanoanilino)benzoic acid.
| Compound Name | 5-amino-2-[4-(2-cyanoethyl)-2,6-dimethylphenoxy]-4-(4-isocyanoanilino)benzoic acid |
|---|---|
| PubChem CID | 123724384 |
| Molecular Formula | C25H22N4O3 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 5-amino-2-[4-(2-cyanoethyl)-2,6-dimethylphenoxy]-4-(4-isocyanoanilino)benzoic acid |
| SMILES | [C-]#[N+]c1ccc(Nc2cc(Oc3c(C)cc(CCC#N)cc3C)c(C(=O)O)cc2N)cc1 |
| InChI | InChI=1S/C25H22N4O3/c1-15-11-17(5-4-10-26)12-16(2)24(15)32-23-14-22(21(27)13-20(23)25(30)31)29-19-8-6-18(28-3)7-9-19/h6-9,11-14,29H,4-5,27H2,1-2H3,(H,30,31) |
| InChIKey | LEVYBTDQJVBBKW-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|