About methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate
methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate (PubChem CID 123724423) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate |
| PubChem CID | 123724423 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate |
| SMILES | CC=C/C(=N\C)C1=NOC(C)(C(=O)OC)C1 |
| InChI | InChI=1S/C11H16N2O3/c1-5-6-8(12-3)9-7-11(2,16-13-9)10(14)15-4/h5-6H,7H2,1-4H3/b6-5?,12-8+ |
| InChIKey | OUKCQDMEDFRVIM-XANFTUCWSA-N |
| XLogP | 1.34 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate?
The IUPAC name of methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate (CID 123724423) is methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate.
What is the SMILES notation for methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate?
The canonical SMILES for methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate is CC=C/C(=N\C)C1=NOC(C)(C(=O)OC)C1.
What is the InChIKey of methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate?
The InChIKey is OUKCQDMEDFRVIM-XANFTUCWSA-N. The full InChI is InChI=1S/C11H16N2O3/c1-5-6-8(12-3)9-7-11(2,16-13-9)10(14)15-4/h5-6H,7H2,1-4H3/b6-5?,12-8+.
What are the key properties of methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate?
methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate has a molecular weight of 224.26 g/mol, XLogP of 1.34, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-methyl-3-(N-methyl-C-prop-1-enylcarbonimidoyl)-4H-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 123724423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).