C10H20 — CID 123725003
2,3-dimethyl-4-methylideneheptane (PubChem CID 123725003) has the molecular formula C10H20 and a molecular weight of 140.27 g/mol. Its IUPAC name is 2,3-dimethyl-4-methylideneheptane.
| Compound Name | 2,3-dimethyl-4-methylideneheptane |
|---|---|
| PubChem CID | 123725003 |
| Molecular Formula | C10H20 |
| Molecular Weight | 140.27 g/mol |
| Exact Mass | 140.16 |
| IUPAC Name | 2,3-dimethyl-4-methylideneheptane |
| SMILES | C=C(CCC)C(C)C(C)C |
| InChI | InChI=1S/C10H20/c1-6-7-9(4)10(5)8(2)3/h8,10H,4,6-7H2,1-3,5H3 |
| InChIKey | CUSSMDHCHYXKPC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.27 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|