C32H45N5O6Si — CID 123725233
14-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,11-dimethyl-3-oxa-9,12,15,21,29-pentazatetracyclo[18.5.3.15,9.023,27]nonacosa-1(26),18,20,22,24,27-hexaene-4,10,13,16-tetrone (PubChem CID 123725233) has the molecular formula C32H45N5O6Si and a molecular weight of 623.83 g/mol. Its IUPAC name is 14-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,11-dimethyl-3-oxa-9,12,15,21,29-pentazatetracyclo[18.5.3.15,9.023,27]nonacosa-1(26),18,20,22,24,27-hexaene-4,10,13,16-tetrone.
| Compound Name | 14-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,11-dimethyl-3-oxa-9,12,15,21,29-pentazatetracyclo[18.5.3.15,9.023,27]nonacosa-1(26),18,20,22,24,27-hexaene-4,10,13,16-tetrone |
|---|---|
| PubChem CID | 123725233 |
| Molecular Formula | C32H45N5O6Si |
| Molecular Weight | 623.83 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | 14-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,11-dimethyl-3-oxa-9,12,15,21,29-pentazatetracyclo[18.5.3.15,9.023,27]nonacosa-1(26),18,20,22,24,27-hexaene-4,10,13,16-tetrone |
| SMILES | CC1NC(=O)C(CO[Si](C)(C)C(C)(C)C)NC(=O)CC=Cc2cc3cc(ccc3cn2)C(C)OC(=O)C2CCCN(N2)C1=O |
| InChI | InChI=1S/C32H45N5O6Si/c1-20-30(40)37-15-9-11-26(36-37)31(41)43-21(2)22-13-14-23-18-33-25(17-24(23)16-22)10-8-12-28(38)35-27(29(39)34-20)19-42-44(6,7)32(3,4)5/h8,10,13-14,16-18,20-21,26-27,36H,9,11-12,15,19H2,1-7H3,(H,34,39)(H,35,38) |
| InChIKey | ATNSWUSUEJCYMU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 138.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.83 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|