About 1-hexa-2,4-dien-3-ylpiperazine
1-hexa-2,4-dien-3-ylpiperazine (PubChem CID 123725509) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-hexa-2,4-dien-3-ylpiperazine.
Molecular Properties
| Compound Name | 1-hexa-2,4-dien-3-ylpiperazine |
| PubChem CID | 123725509 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-hexa-2,4-dien-3-ylpiperazine |
| SMILES | CC=CC(=CC)N1CCNCC1 |
| InChI | InChI=1S/C10H18N2/c1-3-5-10(4-2)12-8-6-11-7-9-12/h3-5,11H,6-9H2,1-2H3 |
| InChIKey | YOPHMTFOIWOJJV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-hexa-2,4-dien-3-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexa-2,4-dien-3-ylpiperazine?
The IUPAC name of 1-hexa-2,4-dien-3-ylpiperazine (CID 123725509) is 1-hexa-2,4-dien-3-ylpiperazine.
What is the SMILES notation for 1-hexa-2,4-dien-3-ylpiperazine?
The canonical SMILES for 1-hexa-2,4-dien-3-ylpiperazine is CC=CC(=CC)N1CCNCC1.
What is the InChIKey of 1-hexa-2,4-dien-3-ylpiperazine?
The InChIKey is YOPHMTFOIWOJJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-3-5-10(4-2)12-8-6-11-7-9-12/h3-5,11H,6-9H2,1-2H3.
What are the key properties of 1-hexa-2,4-dien-3-ylpiperazine?
1-hexa-2,4-dien-3-ylpiperazine has a molecular weight of 166.27 g/mol, XLogP of 1.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexa-2,4-dien-3-ylpiperazine is sourced from PubChem (CID 123725509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).