C15H19IO2 — CID 123725623
1-cyclohexyl-1-hydroxy-1-(2-iodophenyl)propan-2-one (PubChem CID 123725623) has the molecular formula C15H19IO2 and a molecular weight of 358.22 g/mol. Its IUPAC name is 1-cyclohexyl-1-hydroxy-1-(2-iodophenyl)propan-2-one.
| Compound Name | 1-cyclohexyl-1-hydroxy-1-(2-iodophenyl)propan-2-one |
|---|---|
| PubChem CID | 123725623 |
| Molecular Formula | C15H19IO2 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 1-cyclohexyl-1-hydroxy-1-(2-iodophenyl)propan-2-one |
| SMILES | CC(=O)C(O)(c1ccccc1I)C1CCCCC1 |
| InChI | InChI=1S/C15H19IO2/c1-11(17)15(18,12-7-3-2-4-8-12)13-9-5-6-10-14(13)16/h5-6,9-10,12,18H,2-4,7-8H2,1H3 |
| InChIKey | LRRIDIGRCAHSNL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|