C28H36N4O4S — CID 123725657
ethane;2-[(2-hydroxyethylamino)methyl]-N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-4-methylsulfonylbenzamide (PubChem CID 123725657) has the molecular formula C28H36N4O4S and a molecular weight of 524.69 g/mol. Its IUPAC name is ethane;2-[(2-hydroxyethylamino)methyl]-N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-4-methylsulfonylbenzamide.
| Compound Name | ethane;2-[(2-hydroxyethylamino)methyl]-N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-4-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 123725657 |
| Molecular Formula | C28H36N4O4S |
| Molecular Weight | 524.69 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | ethane;2-[(2-hydroxyethylamino)methyl]-N-(4-imidazo[1,2-a]pyridin-2-ylphenyl)-4-methylsulfonylbenzamide |
| SMILES | CC.CC.CS(=O)(=O)c1ccc(C(=O)Nc2ccc(-c3cn4ccccc4n3)cc2)c(CNCCO)c1 |
| InChI | InChI=1S/C24H24N4O4S.2C2H6/c1-33(31,32)20-9-10-21(18(14-20)15-25-11-13-29)24(30)26-19-7-5-17(6-8-19)22-16-28-12-3-2-4-23(28)27-22;2*1-2/h2-10,12,14,16,25,29H,11,13,15H2,1H3,(H,26,30);2*1-2H3 |
| InChIKey | XONWGZMCJWXLJV-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.69 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|