C22H28N4OS — CID 123725874
N-(6-methoxy-3-pyridinyl)-2,3-dimethylspiro[3,4-dihydroisoquinoline-1,4'-piperidine]-1'-carbothioamide (PubChem CID 123725874) has the molecular formula C22H28N4OS and a molecular weight of 396.56 g/mol. Its IUPAC name is N-(6-methoxy-3-pyridinyl)-2,3-dimethylspiro[3,4-dihydroisoquinoline-1,4'-piperidine]-1'-carbothioamide.
| Compound Name | N-(6-methoxy-3-pyridinyl)-2,3-dimethylspiro[3,4-dihydroisoquinoline-1,4'-piperidine]-1'-carbothioamide |
|---|---|
| PubChem CID | 123725874 |
| Molecular Formula | C22H28N4OS |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | N-(6-methoxy-3-pyridinyl)-2,3-dimethylspiro[3,4-dihydroisoquinoline-1,4'-piperidine]-1'-carbothioamide |
| SMILES | COc1ccc(NC(=S)N2CCC3(CC2)c2ccccc2CC(C)N3C)cn1 |
| InChI | InChI=1S/C22H28N4OS/c1-16-14-17-6-4-5-7-19(17)22(25(16)2)10-12-26(13-11-22)21(28)24-18-8-9-20(27-3)23-15-18/h4-9,15-16H,10-14H2,1-3H3,(H,24,28) |
| InChIKey | DFANGTUMCKOOCE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|