C8H11F2N — CID 123726188
(3Z)-2,6-difluoro-N,4-dimethylhexa-3,5-dien-1-imine (PubChem CID 123726188) has the molecular formula C8H11F2N and a molecular weight of 159.18 g/mol. Its IUPAC name is (3Z)-2,6-difluoro-N,4-dimethylhexa-3,5-dien-1-imine.
| Compound Name | (3Z)-2,6-difluoro-N,4-dimethylhexa-3,5-dien-1-imine |
|---|---|
| PubChem CID | 123726188 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (3Z)-2,6-difluoro-N,4-dimethylhexa-3,5-dien-1-imine |
| SMILES | C/N=C/C(F)/C=C(/C)C=CF |
| InChI | InChI=1S/C8H11F2N/c1-7(3-4-9)5-8(10)6-11-2/h3-6,8H,1-2H3/b4-3?,7-5-,11-6+ |
| InChIKey | QFTMKLLQDHRSQN-OAIMHOCXSA-N |
| XLogP | 2.45 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|