C25H40F6O5 — CID 123726816
[2-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propyl]-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]methyl 2-tert-butyl-2-methylpentanoate (PubChem CID 123726816) has the molecular formula C25H40F6O5 and a molecular weight of 534.58 g/mol. Its IUPAC name is [2-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propyl]-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]methyl 2-tert-butyl-2-methylpentanoate.
| Compound Name | [2-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propyl]-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]methyl 2-tert-butyl-2-methylpentanoate |
|---|---|
| PubChem CID | 123726816 |
| Molecular Formula | C25H40F6O5 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.28 |
| IUPAC Name | [2-[3-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)propyl]-2-methyl-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]methyl 2-tert-butyl-2-methylpentanoate |
| SMILES | CCCC(C)(C(=O)OCC1CCC2OC(C)(CCCOC(C(F)(F)F)C(F)(F)F)OC2C1)C(C)(C)C |
| InChI | InChI=1S/C25H40F6O5/c1-7-11-22(5,21(2,3)4)20(32)34-15-16-9-10-17-18(14-16)36-23(6,35-17)12-8-13-33-19(24(26,27)28)25(29,30)31/h16-19H,7-15H2,1-6H3 |
| InChIKey | JZXKZHUBJQGZMC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|