C22H26FN7OS — CID 123726844
N-(1-aminoethylidene)-4-[[8-[(4-fluorophenyl)-methoxymethyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]piperidine-1-carbothioamide (PubChem CID 123726844) has the molecular formula C22H26FN7OS and a molecular weight of 455.56 g/mol. Its IUPAC name is N-(1-aminoethylidene)-4-[[8-[(4-fluorophenyl)-methoxymethyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]piperidine-1-carbothioamide.
| Compound Name | N-(1-aminoethylidene)-4-[[8-[(4-fluorophenyl)-methoxymethyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 123726844 |
| Molecular Formula | C22H26FN7OS |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | N-(1-aminoethylidene)-4-[[8-[(4-fluorophenyl)-methoxymethyl]-[1,2,4]triazolo[1,5-a]pyridin-2-yl]amino]piperidine-1-carbothioamide |
| SMILES | COC(c1ccc(F)cc1)c1cccn2nc(NC3CCN(C(=S)N=C(C)N)CC3)nc12 |
| InChI | InChI=1S/C22H26FN7OS/c1-14(24)25-22(32)29-12-9-17(10-13-29)26-21-27-20-18(4-3-11-30(20)28-21)19(31-2)15-5-7-16(23)8-6-15/h3-8,11,17,19H,9-10,12-13H2,1-2H3,(H,26,28)(H2,24,25,32) |
| InChIKey | JCPFWNXFSZIGJB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 93.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|