C17H29NO4 — CID 123727008
2-(3,4-dihydroxypyrrol-1-yl)ethyl undecanoate (PubChem CID 123727008) has the molecular formula C17H29NO4 and a molecular weight of 311.42 g/mol. Its IUPAC name is 2-(3,4-dihydroxypyrrol-1-yl)ethyl undecanoate.
| Compound Name | 2-(3,4-dihydroxypyrrol-1-yl)ethyl undecanoate |
|---|---|
| PubChem CID | 123727008 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | 2-(3,4-dihydroxypyrrol-1-yl)ethyl undecanoate |
| SMILES | CCCCCCCCCCC(=O)OCCn1cc(O)c(O)c1 |
| InChI | InChI=1S/C17H29NO4/c1-2-3-4-5-6-7-8-9-10-17(21)22-12-11-18-13-15(19)16(20)14-18/h13-14,19-20H,2-12H2,1H3 |
| InChIKey | LPMSNSSKVFPTMT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|