About 9-fluoro-10-methyldodeca-1,2-diene
9-fluoro-10-methyldodeca-1,2-diene (PubChem CID 123728117) has the molecular formula C13H23F
and a molecular weight of 198.32 g/mol. Its IUPAC name is 9-fluoro-10-methyldodeca-1,2-diene.
Molecular Properties
| Compound Name | 9-fluoro-10-methyldodeca-1,2-diene |
| PubChem CID | 123728117 |
| Molecular Formula | C13H23F |
| Molecular Weight | 198.32 g/mol |
| Exact Mass | 198.18 |
| IUPAC Name | 9-fluoro-10-methyldodeca-1,2-diene |
| SMILES | C=C=CCCCCCC(F)C(C)CC |
| InChI | InChI=1S/C13H23F/c1-4-6-7-8-9-10-11-13(14)12(3)5-2/h6,12-13H,1,5,7-11H2,2-3H3 |
| InChIKey | BOPLZYZUBVNDCO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-fluoro-10-methyldodeca-1,2-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-fluoro-10-methyldodeca-1,2-diene?
The IUPAC name of 9-fluoro-10-methyldodeca-1,2-diene (CID 123728117) is 9-fluoro-10-methyldodeca-1,2-diene.
What is the SMILES notation for 9-fluoro-10-methyldodeca-1,2-diene?
The canonical SMILES for 9-fluoro-10-methyldodeca-1,2-diene is C=C=CCCCCCC(F)C(C)CC.
What is the InChIKey of 9-fluoro-10-methyldodeca-1,2-diene?
The InChIKey is BOPLZYZUBVNDCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F/c1-4-6-7-8-9-10-11-13(14)12(3)5-2/h6,12-13H,1,5,7-11H2,2-3H3.
What are the key properties of 9-fluoro-10-methyldodeca-1,2-diene?
9-fluoro-10-methyldodeca-1,2-diene has a molecular weight of 198.32 g/mol, XLogP of 4.66, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-fluoro-10-methyldodeca-1,2-diene is sourced from PubChem (CID 123728117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).