C36H36ClN7O4S — CID 123728257
N-[4-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]piperidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide (PubChem CID 123728257) has the molecular formula C36H36ClN7O4S and a molecular weight of 698.25 g/mol. Its IUPAC name is N-[4-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]piperidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide.
| Compound Name | N-[4-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]piperidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 123728257 |
| Molecular Formula | C36H36ClN7O4S |
| Molecular Weight | 698.25 g/mol |
| Exact Mass | 697.22 |
| IUPAC Name | N-[4-[3-[[4-[1-(benzenesulfonyl)indol-3-yl]-5-chloropyrimidin-2-yl]amino]piperidine-1-carbonyl]phenyl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)CC=CC(=O)Nc1ccc(C(=O)N2CCCC(Nc3ncc(Cl)c(-c4cn(S(=O)(=O)c5ccccc5)c5ccccc45)n3)C2)cc1 |
| InChI | InChI=1S/C36H36ClN7O4S/c1-42(2)20-9-15-33(45)39-26-18-16-25(17-19-26)35(46)43-21-8-10-27(23-43)40-36-38-22-31(37)34(41-36)30-24-44(32-14-7-6-13-29(30)32)49(47,48)28-11-4-3-5-12-28/h3-7,9,11-19,22,24,27H,8,10,20-21,23H2,1-2H3,(H,39,45)(H,38,40,41) |
| InChIKey | LJJSZKFMOZREGT-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 129.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.25 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|