C17H17F2NO — CID 123728386
1-(3,6-difluorocarbazol-9-yl)-2-methylbutan-2-ol (PubChem CID 123728386) has the molecular formula C17H17F2NO and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-(3,6-difluorocarbazol-9-yl)-2-methylbutan-2-ol.
| Compound Name | 1-(3,6-difluorocarbazol-9-yl)-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 123728386 |
| Molecular Formula | C17H17F2NO |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-(3,6-difluorocarbazol-9-yl)-2-methylbutan-2-ol |
| SMILES | CCC(C)(O)Cn1c2ccc(F)cc2c2cc(F)ccc21 |
| InChI | InChI=1S/C17H17F2NO/c1-3-17(2,21)10-20-15-6-4-11(18)8-13(15)14-9-12(19)5-7-16(14)20/h4-9,21H,3,10H2,1-2H3 |
| InChIKey | FQLCMJTXIRSQPK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |