About N-(diaminomethylidene)-1,3-oxazole-4-carboxamide
N-(diaminomethylidene)-1,3-oxazole-4-carboxamide (PubChem CID 123728548) has the molecular formula C5H6N4O2
and a molecular weight of 154.13 g/mol. Its IUPAC name is N-(diaminomethylidene)-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(diaminomethylidene)-1,3-oxazole-4-carboxamide |
| PubChem CID | 123728548 |
| Molecular Formula | C5H6N4O2 |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | N-(diaminomethylidene)-1,3-oxazole-4-carboxamide |
| SMILES | NC(N)=NC(=O)c1cocn1 |
| InChI | InChI=1S/C5H6N4O2/c6-5(7)9-4(10)3-1-11-2-8-3/h1-2H,(H4,6,7,9,10) |
| InChIKey | BICFOVVRADTXLF-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)-1,3-oxazole-4-carboxamide?
The IUPAC name of N-(diaminomethylidene)-1,3-oxazole-4-carboxamide (CID 123728548) is N-(diaminomethylidene)-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-(diaminomethylidene)-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-(diaminomethylidene)-1,3-oxazole-4-carboxamide is NC(N)=NC(=O)c1cocn1.
What is the InChIKey of N-(diaminomethylidene)-1,3-oxazole-4-carboxamide?
The InChIKey is BICFOVVRADTXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O2/c6-5(7)9-4(10)3-1-11-2-8-3/h1-2H,(H4,6,7,9,10).
What are the key properties of N-(diaminomethylidene)-1,3-oxazole-4-carboxamide?
N-(diaminomethylidene)-1,3-oxazole-4-carboxamide has a molecular weight of 154.13 g/mol, XLogP of -0.91, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 123728548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).