C11H12N2O2S — CID 123728999
3,8-dimethyl-2-methylsulfinylquinazolin-4-one (PubChem CID 123728999) has the molecular formula C11H12N2O2S and a molecular weight of 236.30 g/mol. Its IUPAC name is 3,8-dimethyl-2-methylsulfinylquinazolin-4-one.
| Compound Name | 3,8-dimethyl-2-methylsulfinylquinazolin-4-one |
|---|---|
| PubChem CID | 123728999 |
| Molecular Formula | C11H12N2O2S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | 3,8-dimethyl-2-methylsulfinylquinazolin-4-one |
| SMILES | Cc1cccc2c(=O)n(C)c(S(C)=O)nc12 |
| InChI | InChI=1S/C11H12N2O2S/c1-7-5-4-6-8-9(7)12-11(16(3)15)13(2)10(8)14/h4-6H,1-3H3 |
| InChIKey | MRTGGWHCBMSYKD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |