C10H13NO — CID 123729020
4-(4H-pyran-2-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 123729020) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is 4-(4H-pyran-2-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(4H-pyran-2-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 123729020 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 4-(4H-pyran-2-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | C1=COC(C2=CCNCC2)=CC1 |
| InChI | InChI=1S/C10H13NO/c1-2-8-12-10(3-1)9-4-6-11-7-5-9/h2-4,8,11H,1,5-7H2 |
| InChIKey | NNFNQYNAKOCTEA-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |