C54H38N2S — CID 123729352
N-[4-(1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaen-10-yl)phenyl]-4-dibenzothiophen-2-yl-N-(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl)aniline (PubChem CID 123729352) has the molecular formula C54H38N2S and a molecular weight of 746.98 g/mol. Its IUPAC name is N-[4-(1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaen-10-yl)phenyl]-4-dibenzothiophen-2-yl-N-(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl)aniline.
| Compound Name | N-[4-(1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaen-10-yl)phenyl]-4-dibenzothiophen-2-yl-N-(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl)aniline |
|---|---|
| PubChem CID | 123729352 |
| Molecular Formula | C54H38N2S |
| Molecular Weight | 746.98 g/mol |
| Exact Mass | 746.28 |
| IUPAC Name | N-[4-(1-azapentacyclo[10.6.1.02,7.08,19.013,18]nonadeca-2,4,6,8,10,12(19),13,15,17-nonaen-10-yl)phenyl]-4-dibenzothiophen-2-yl-N-(5,6-dimethylidenedeca-1,3,7,9-tetraen-2-yl)aniline |
| SMILES | C=CC=CC(=C)C(=C)C=CC(=C)N(c1ccc(-c2ccc3sc4ccccc4c3c2)cc1)c1ccc(-c2cc3c4ccccc4n4c5ccccc5c(c2)c34)cc1 |
| InChI | InChI=1S/C54H38N2S/c1-5-6-13-35(2)36(3)20-21-37(4)55(42-27-22-38(23-28-42)40-26-31-53-47(32-40)46-16-9-12-19-52(46)57-53)43-29-24-39(25-30-43)41-33-48-44-14-7-10-17-50(44)56-51-18-11-8-15-45(51)49(34-41)54(48)56/h5-34H,1-4H2 |
| InChIKey | AVZYOFGEMJDZIM-UHFFFAOYSA-N |
| XLogP | 15.60 |
| TPSA | 7.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.98 |
| LogP ≤ 5 | 15.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|