C40H44BF3N6O5 — CID 123729759
[4-[2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]ethoxy]ethyl]piperazin-1-yl]-[3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]methanone (PubChem CID 123729759) has the molecular formula C40H44BF3N6O5 and a molecular weight of 756.64 g/mol. Its IUPAC name is [4-[2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]ethoxy]ethyl]piperazin-1-yl]-[3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]methanone.
| Compound Name | [4-[2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]ethoxy]ethyl]piperazin-1-yl]-[3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]methanone |
|---|---|
| PubChem CID | 123729759 |
| Molecular Formula | C40H44BF3N6O5 |
| Molecular Weight | 756.64 g/mol |
| Exact Mass | 756.34 |
| IUPAC Name | [4-[2-[2-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]ethoxy]ethyl]piperazin-1-yl]-[3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]methanone |
| SMILES | CC1(C)OB(c2ccc3c(ccn3CCOCCN3CCN(C(=O)c4cccc(-c5cc(Nc6ccc(OC(F)(F)F)cc6)ncn5)c4)CC3)c2)OC1(C)C |
| InChI | InChI=1S/C40H44BF3N6O5/c1-38(2)39(3,4)55-41(54-38)31-8-13-35-29(25-31)14-15-49(35)21-23-52-22-20-48-16-18-50(19-17-48)37(51)30-7-5-6-28(24-30)34-26-36(46-27-45-34)47-32-9-11-33(12-10-32)53-40(42,43)44/h5-15,24-27H,16-23H2,1-4H3,(H,45,46,47) |
| InChIKey | BWRGDDJWGXCRBX-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 103.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.64 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|