About 5-chloro-3-methyl-3a,6-dihydrobenzotriazole
5-chloro-3-methyl-3a,6-dihydrobenzotriazole (PubChem CID 123730448) has the molecular formula C7H8ClN3
and a molecular weight of 169.61 g/mol. Its IUPAC name is 5-chloro-3-methyl-3a,6-dihydrobenzotriazole.
Molecular Properties
| Compound Name | 5-chloro-3-methyl-3a,6-dihydrobenzotriazole |
| PubChem CID | 123730448 |
| Molecular Formula | C7H8ClN3 |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.04 |
| IUPAC Name | 5-chloro-3-methyl-3a,6-dihydrobenzotriazole |
| SMILES | CN1N=NC2=CCC(Cl)=CC21 |
| InChI | InChI=1S/C7H8ClN3/c1-11-7-4-5(8)2-3-6(7)9-10-11/h3-4,7H,2H2,1H3 |
| InChIKey | FYGCTWZAILWKPI-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-3-methyl-3a,6-dihydrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-3-methyl-3a,6-dihydrobenzotriazole?
The IUPAC name of 5-chloro-3-methyl-3a,6-dihydrobenzotriazole (CID 123730448) is 5-chloro-3-methyl-3a,6-dihydrobenzotriazole.
What is the SMILES notation for 5-chloro-3-methyl-3a,6-dihydrobenzotriazole?
The canonical SMILES for 5-chloro-3-methyl-3a,6-dihydrobenzotriazole is CN1N=NC2=CCC(Cl)=CC21.
What is the InChIKey of 5-chloro-3-methyl-3a,6-dihydrobenzotriazole?
The InChIKey is FYGCTWZAILWKPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClN3/c1-11-7-4-5(8)2-3-6(7)9-10-11/h3-4,7H,2H2,1H3.
What are the key properties of 5-chloro-3-methyl-3a,6-dihydrobenzotriazole?
5-chloro-3-methyl-3a,6-dihydrobenzotriazole has a molecular weight of 169.61 g/mol, XLogP of 2.08, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-3-methyl-3a,6-dihydrobenzotriazole is sourced from PubChem (CID 123730448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).