C48H58F3NO9 — CID 123730739
2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol;[2-[(6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate;(4-phenylphenyl) 2,2-dimethylbutanoate (PubChem CID 123730739) has the molecular formula C48H58F3NO9 and a molecular weight of 849.98 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol;[2-[(6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate;(4-phenylphenyl) 2,2-dimethylbutanoate.
| Compound Name | 2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol;[2-[(6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate;(4-phenylphenyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 123730739 |
| Molecular Formula | C48H58F3NO9 |
| Molecular Weight | 849.98 g/mol |
| Exact Mass | 849.41 |
| IUPAC Name | 2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol;[2-[(6-cyano-5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]-2-oxoethyl] 2,2-dimethylbutanoate;(4-phenylphenyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCC(=O)OC1C2CC3C1OC(=O)C3(C#N)C2.CCC(C)(C)C(=O)Oc1ccc(-c2ccccc2)cc1.CCC(C)c1ccc(C(C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H20O2.C17H21NO6.C13H17F3O/c1-4-18(2,3)17(19)20-16-12-10-15(11-13-16)14-8-6-5-7-9-14;1-4-16(2,3)14(20)22-7-11(19)23-12-9-5-10-13(12)24-15(21)17(10,6-9)8-18;1-4-9(2)10-5-7-11(8-6-10)12(3,17)13(14,15)16/h5-13H,4H2,1-3H3;9-10,12-13H,4-7H2,1-3H3;5-9,17H,4H2,1-3H3 |
| InChIKey | MXSLUTSLWZFCSU-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 149.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.98 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|