About N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide
N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide (PubChem CID 123730947) has the molecular formula C7H9FN2OS
and a molecular weight of 188.23 g/mol. Its IUPAC name is N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide |
| PubChem CID | 123730947 |
| Molecular Formula | C7H9FN2OS |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide |
| SMILES | CCN(C)C(=O)c1csc(F)n1 |
| InChI | InChI=1S/C7H9FN2OS/c1-3-10(2)6(11)5-4-12-7(8)9-5/h4H,3H2,1-2H3 |
| InChIKey | NZRRZWXQDWCOTJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide?
The IUPAC name of N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide (CID 123730947) is N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide?
The canonical SMILES for N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide is CCN(C)C(=O)c1csc(F)n1.
What is the InChIKey of N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide?
The InChIKey is NZRRZWXQDWCOTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9FN2OS/c1-3-10(2)6(11)5-4-12-7(8)9-5/h4H,3H2,1-2H3.
What are the key properties of N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide?
N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide has a molecular weight of 188.23 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-fluoro-N-methyl-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 123730947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).