About 3,5-dichloronona-5,7-diene-4-thiol
3,5-dichloronona-5,7-diene-4-thiol (PubChem CID 123731851) has the molecular formula C9H14Cl2S
and a molecular weight of 225.18 g/mol. Its IUPAC name is 3,5-dichloronona-5,7-diene-4-thiol.
Molecular Properties
| Compound Name | 3,5-dichloronona-5,7-diene-4-thiol |
| PubChem CID | 123731851 |
| Molecular Formula | C9H14Cl2S |
| Molecular Weight | 225.18 g/mol |
| Exact Mass | 224.02 |
| IUPAC Name | 3,5-dichloronona-5,7-diene-4-thiol |
| SMILES | CC=CC=C(Cl)C(S)C(Cl)CC |
| InChI | InChI=1S/C9H14Cl2S/c1-3-5-6-8(11)9(12)7(10)4-2/h3,5-7,9,12H,4H2,1-2H3 |
| InChIKey | GXSUTOQJRVYLSX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.18 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloronona-5,7-diene-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloronona-5,7-diene-4-thiol?
The IUPAC name of 3,5-dichloronona-5,7-diene-4-thiol (CID 123731851) is 3,5-dichloronona-5,7-diene-4-thiol.
What is the SMILES notation for 3,5-dichloronona-5,7-diene-4-thiol?
The canonical SMILES for 3,5-dichloronona-5,7-diene-4-thiol is CC=CC=C(Cl)C(S)C(Cl)CC.
What is the InChIKey of 3,5-dichloronona-5,7-diene-4-thiol?
The InChIKey is GXSUTOQJRVYLSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14Cl2S/c1-3-5-6-8(11)9(12)7(10)4-2/h3,5-7,9,12H,4H2,1-2H3.
What are the key properties of 3,5-dichloronona-5,7-diene-4-thiol?
3,5-dichloronona-5,7-diene-4-thiol has a molecular weight of 225.18 g/mol, XLogP of 4.00, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloronona-5,7-diene-4-thiol is sourced from PubChem (CID 123731851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).