C30H42N4O5Si — CID 123731861
ethyl 4-[[5-[4-[5-ethoxy-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]cyclohexane-1-carboxylate (PubChem CID 123731861) has the molecular formula C30H42N4O5Si and a molecular weight of 566.78 g/mol. Its IUPAC name is ethyl 4-[[5-[4-[5-ethoxy-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]cyclohexane-1-carboxylate.
| Compound Name | ethyl 4-[[5-[4-[5-ethoxy-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123731861 |
| Molecular Formula | C30H42N4O5Si |
| Molecular Weight | 566.78 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | ethyl 4-[[5-[4-[5-ethoxy-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]cyclohexane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC(Oc2ccc(-c3ccc(-c4nc(OCC)n(COCC[Si](C)(C)C)n4)cc3)cn2)CC1 |
| InChI | InChI=1S/C30H42N4O5Si/c1-6-37-29(35)24-12-15-26(16-13-24)39-27-17-14-25(20-31-27)22-8-10-23(11-9-22)28-32-30(38-7-2)34(33-28)21-36-18-19-40(3,4)5/h8-11,14,17,20,24,26H,6-7,12-13,15-16,18-19,21H2,1-5H3 |
| InChIKey | QCWWEIFPLZZFSQ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.78 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|