About 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide
3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide (PubChem CID 123731966) has the molecular formula C13H19N5
and a molecular weight of 245.33 g/mol. Its IUPAC name is 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide.
Molecular Properties
| Compound Name | 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide |
| PubChem CID | 123731966 |
| Molecular Formula | C13H19N5 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide |
| SMILES | [H]/N=C(/C/C(N)=N/c1cc(C2CC2)[nH]n1)C1CCC1 |
| InChI | InChI=1S/C13H19N5/c14-10(8-2-1-3-8)6-12(15)16-13-7-11(17-18-13)9-4-5-9/h7-9,14H,1-6H2,(H3,15,16,17,18)/b14-10- |
| InChIKey | RDQHFXVEHMPENN-UVTDQMKNSA-N |
| XLogP | 2.49 |
| TPSA | 90.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide?
The IUPAC name of 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide (CID 123731966) is 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide.
What is the SMILES notation for 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide?
The canonical SMILES for 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide is [H]/N=C(/C/C(N)=N/c1cc(C2CC2)[nH]n1)C1CCC1.
What is the InChIKey of 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide?
The InChIKey is RDQHFXVEHMPENN-UVTDQMKNSA-N. The full InChI is InChI=1S/C13H19N5/c14-10(8-2-1-3-8)6-12(15)16-13-7-11(17-18-13)9-4-5-9/h7-9,14H,1-6H2,(H3,15,16,17,18)/b14-10-.
What are the key properties of 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide?
3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide has a molecular weight of 245.33 g/mol, XLogP of 2.49, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutyl-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-iminopropanimidamide is sourced from PubChem (CID 123731966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).