About 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane
3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane (PubChem CID 123732278) has the molecular formula C13H28OSi
and a molecular weight of 228.45 g/mol. Its IUPAC name is 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane.
Molecular Properties
| Compound Name | 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane |
| PubChem CID | 123732278 |
| Molecular Formula | C13H28OSi |
| Molecular Weight | 228.45 g/mol |
| Exact Mass | 228.19 |
| IUPAC Name | 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane |
| SMILES | C=C(C[SiH2]OCCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H28OSi/c1-11(13(5,6)7)10-15-14-9-8-12(2,3)4/h1,8-10,15H2,2-7H3 |
| InChIKey | JVLRJIZCVUYBDE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane?
The IUPAC name of 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane (CID 123732278) is 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane.
What is the SMILES notation for 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane?
The canonical SMILES for 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane is C=C(C[SiH2]OCCC(C)(C)C)C(C)(C)C.
What is the InChIKey of 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane?
The InChIKey is JVLRJIZCVUYBDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28OSi/c1-11(13(5,6)7)10-15-14-9-8-12(2,3)4/h1,8-10,15H2,2-7H3.
What are the key properties of 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane?
3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane has a molecular weight of 228.45 g/mol, XLogP of 3.54, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutoxy-(3,3-dimethyl-2-methylidenebutyl)silane is sourced from PubChem (CID 123732278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).