C22H34BN3O3 — CID 123732388
N-(2-ethoxyethyl)-N-methyl-2-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-1-yl]ethanamine (PubChem CID 123732388) has the molecular formula C22H34BN3O3 and a molecular weight of 399.34 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-N-methyl-2-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-1-yl]ethanamine.
| Compound Name | N-(2-ethoxyethyl)-N-methyl-2-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-1-yl]ethanamine |
|---|---|
| PubChem CID | 123732388 |
| Molecular Formula | C22H34BN3O3 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.27 |
| IUPAC Name | N-(2-ethoxyethyl)-N-methyl-2-[4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrazol-1-yl]ethanamine |
| SMILES | CCOCCN(C)CCn1cc(-c2cccc(B3OC(C)(C)C(C)(C)O3)c2)cn1 |
| InChI | InChI=1S/C22H34BN3O3/c1-7-27-14-13-25(6)11-12-26-17-19(16-24-26)18-9-8-10-20(15-18)23-28-21(2,3)22(4,5)29-23/h8-10,15-17H,7,11-14H2,1-6H3 |
| InChIKey | YOPZNRQUVHMUHO-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|