C16H23BN2O2 — CID 123732920
N-benzyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propane-1,3-diimine (PubChem CID 123732920) has the molecular formula C16H23BN2O2 and a molecular weight of 286.18 g/mol. Its IUPAC name is N-benzyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propane-1,3-diimine.
| Compound Name | N-benzyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propane-1,3-diimine |
|---|---|
| PubChem CID | 123732920 |
| Molecular Formula | C16H23BN2O2 |
| Molecular Weight | 286.18 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | N-benzyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)propane-1,3-diimine |
| SMILES | [H]/N=C/C(/C=N/Cc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H23BN2O2/c1-15(2)16(3,4)21-17(20-15)14(10-18)12-19-11-13-8-6-5-7-9-13/h5-10,12,14,18H,11H2,1-4H3/b18-10+,19-12+ |
| InChIKey | SOGXPGRJNFMUNP-UBIAKTOFSA-N |
| XLogP | 3.37 |
| TPSA | 54.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.18 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|