C21H23N6O4S+ — CID 123732972
[3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-[4-methyl-2-(methylamino)-1H-indol-5-yl]phenyl]-dihydroxy-methylazanium (PubChem CID 123732972) has the molecular formula C21H23N6O4S+ and a molecular weight of 455.52 g/mol. Its IUPAC name is [3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-[4-methyl-2-(methylamino)-1H-indol-5-yl]phenyl]-dihydroxy-methylazanium.
| Compound Name | [3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-[4-methyl-2-(methylamino)-1H-indol-5-yl]phenyl]-dihydroxy-methylazanium |
|---|---|
| PubChem CID | 123732972 |
| Molecular Formula | C21H23N6O4S+ |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | [3-[3-(carboxymethylsulfanyl)-1H-1,2,4-triazol-5-yl]-5-[4-methyl-2-(methylamino)-1H-indol-5-yl]phenyl]-dihydroxy-methylazanium |
| SMILES | CNc1cc2c(C)c(-c3cc(-c4nc(SCC(=O)O)n[nH]4)cc([N+](C)(O)O)c3)ccc2[nH]1 |
| InChI | InChI=1S/C21H22N6O4S/c1-11-15(4-5-17-16(11)9-18(22-2)23-17)12-6-13(8-14(7-12)27(3,30)31)20-24-21(26-25-20)32-10-19(28)29/h4-9,22-23,30-31H,10H2,1-3H3,(H-,24,25,26,28,29)/p+1 |
| InChIKey | FXNHQPHWURGLAC-UHFFFAOYSA-O |
| XLogP | 3.86 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|