C8H14F6O3Si — CID 123733289
ethoxy-ethyl-(1-fluoroethoxy)-(1,1,2,2,2-pentafluoroethoxy)silane (PubChem CID 123733289) has the molecular formula C8H14F6O3Si and a molecular weight of 300.27 g/mol. Its IUPAC name is ethoxy-ethyl-(1-fluoroethoxy)-(1,1,2,2,2-pentafluoroethoxy)silane.
| Compound Name | ethoxy-ethyl-(1-fluoroethoxy)-(1,1,2,2,2-pentafluoroethoxy)silane |
|---|---|
| PubChem CID | 123733289 |
| Molecular Formula | C8H14F6O3Si |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | ethoxy-ethyl-(1-fluoroethoxy)-(1,1,2,2,2-pentafluoroethoxy)silane |
| SMILES | CCO[Si](CC)(OC(C)F)OC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H14F6O3Si/c1-4-15-18(5-2,16-6(3)9)17-8(13,14)7(10,11)12/h6H,4-5H2,1-3H3 |
| InChIKey | IUSIZYAAJLWUJE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|