C11H15F3N2O — CID 123733654
1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-methyl-3-methylidenepiperazin-2-one (PubChem CID 123733654) has the molecular formula C11H15F3N2O and a molecular weight of 248.25 g/mol. Its IUPAC name is 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-methyl-3-methylidenepiperazin-2-one.
| Compound Name | 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-methyl-3-methylidenepiperazin-2-one |
|---|---|
| PubChem CID | 123733654 |
| Molecular Formula | C11H15F3N2O |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 1-(1-cyclopropyl-2,2,2-trifluoroethyl)-4-methyl-3-methylidenepiperazin-2-one |
| SMILES | C=C1C(=O)N(C(C2CC2)C(F)(F)F)CCN1C |
| InChI | InChI=1S/C11H15F3N2O/c1-7-10(17)16(6-5-15(7)2)9(8-3-4-8)11(12,13)14/h8-9H,1,3-6H2,2H3 |
| InChIKey | RBAKXUIUCDVASB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|