C31H56FN6O+ — CID 123733780
3,3-diamino-2-(7-ethyl-3-fluoro-1-azoniabicyclo[5.3.2]dodec-1-en-11-yl)-N-(3-heptyl-1,4,4a,5,6,7,8,8a-octahydro-2,7-naphthyridin-4-yl)propanamide (PubChem CID 123733780) has the molecular formula C31H56FN6O+ and a molecular weight of 547.83 g/mol. Its IUPAC name is 3,3-diamino-2-(7-ethyl-3-fluoro-1-azoniabicyclo[5.3.2]dodec-1-en-11-yl)-N-(3-heptyl-1,4,4a,5,6,7,8,8a-octahydro-2,7-naphthyridin-4-yl)propanamide.
| Compound Name | 3,3-diamino-2-(7-ethyl-3-fluoro-1-azoniabicyclo[5.3.2]dodec-1-en-11-yl)-N-(3-heptyl-1,4,4a,5,6,7,8,8a-octahydro-2,7-naphthyridin-4-yl)propanamide |
|---|---|
| PubChem CID | 123733780 |
| Molecular Formula | C31H56FN6O+ |
| Molecular Weight | 547.83 g/mol |
| Exact Mass | 547.45 |
| IUPAC Name | 3,3-diamino-2-(7-ethyl-3-fluoro-1-azoniabicyclo[5.3.2]dodec-1-en-11-yl)-N-(3-heptyl-1,4,4a,5,6,7,8,8a-octahydro-2,7-naphthyridin-4-yl)propanamide |
| SMILES | CCCCCCCC1=NCC2CNCCC2C1NC(=O)C(C(N)N)C1CC2(CC)CCCC(F)/C=[N+]\1CCC2 |
| InChI | InChI=1S/C31H55FN6O/c1-3-5-6-7-8-12-25-28(24-13-16-35-19-22(24)20-36-25)37-30(39)27(29(33)34)26-18-31(4-2)14-9-11-23(32)21-38(26)17-10-15-31/h21-24,26-29,35H,3-20,33-34H2,1-2H3/p+1/b38-21- |
| InChIKey | YSCCXTMBKVWOJS-GLJXUZQSSA-O |
| XLogP | 3.93 |
| TPSA | 108.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.83 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|