About 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine
1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine (PubChem CID 123733842) has the molecular formula C12H29N3S
and a molecular weight of 247.45 g/mol. Its IUPAC name is 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine.
Molecular Properties
| Compound Name | 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine |
| PubChem CID | 123733842 |
| Molecular Formula | C12H29N3S |
| Molecular Weight | 247.45 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine |
| SMILES | CC/N=C(\N(CC)CC)N(CC)S(C)(C)C |
| InChI | InChI=1S/C12H29N3S/c1-8-13-12(14(9-2)10-3)15(11-4)16(5,6)7/h8-11H2,1-7H3/b13-12+ |
| InChIKey | JZHGGTSJICKXNP-OUKQBFOZSA-N |
| XLogP | 2.63 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine?
The IUPAC name of 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine (CID 123733842) is 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine.
What is the SMILES notation for 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine?
The canonical SMILES for 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine is CC/N=C(\N(CC)CC)N(CC)S(C)(C)C.
What is the InChIKey of 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine?
The InChIKey is JZHGGTSJICKXNP-OUKQBFOZSA-N. The full InChI is InChI=1S/C12H29N3S/c1-8-13-12(14(9-2)10-3)15(11-4)16(5,6)7/h8-11H2,1-7H3/b13-12+.
What are the key properties of 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine?
1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine has a molecular weight of 247.45 g/mol, XLogP of 2.63, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1,2,3-tetraethyl-3-(trimethyl-λ4-sulfanyl)guanidine is sourced from PubChem (CID 123733842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).