C22H27N7O — CID 123733970
2-[2-(3-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pyridine-4-carboximidoyl]-4-propan-2-yloxyaniline (PubChem CID 123733970) has the molecular formula C22H27N7O and a molecular weight of 405.51 g/mol. Its IUPAC name is 2-[2-(3-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pyridine-4-carboximidoyl]-4-propan-2-yloxyaniline.
| Compound Name | 2-[2-(3-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pyridine-4-carboximidoyl]-4-propan-2-yloxyaniline |
|---|---|
| PubChem CID | 123733970 |
| Molecular Formula | C22H27N7O |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 2-[2-(3-ethyl-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)pyridine-4-carboximidoyl]-4-propan-2-yloxyaniline |
| SMILES | [H]/N=C(/c1ccnc(N2CCn3c(CC)nnc3C2)c1)c1cc(OC(C)C)ccc1N |
| InChI | InChI=1S/C22H27N7O/c1-4-19-26-27-21-13-28(9-10-29(19)21)20-11-15(7-8-25-20)22(24)17-12-16(30-14(2)3)5-6-18(17)23/h5-8,11-12,14,24H,4,9-10,13,23H2,1-3H3/b24-22- |
| InChIKey | XFSQWJKUSOCYBH-GYHWCHFESA-N |
| XLogP | 3.04 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|