C20H19Cl2F3N3+ — CID 123734003
1-aminoethylidene-[[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]-methylazanium (PubChem CID 123734003) has the molecular formula C20H19Cl2F3N3+ and a molecular weight of 429.29 g/mol. Its IUPAC name is 1-aminoethylidene-[[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]-methylazanium.
| Compound Name | 1-aminoethylidene-[[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]-methylazanium |
|---|---|
| PubChem CID | 123734003 |
| Molecular Formula | C20H19Cl2F3N3+ |
| Molecular Weight | 429.29 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 1-aminoethylidene-[[4-[3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-1-enyl]phenyl]iminomethyl]-methylazanium |
| SMILES | C/C(N)=[N+](C)\C=N\c1ccc(C=CC(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18Cl2F3N3/c1-13(26)28(2)12-27-18-6-3-14(4-7-18)5-8-19(20(23,24)25)15-9-16(21)11-17(22)10-15/h3-12,19,26H,1-2H3/p+1/b8-5?,27-12+ |
| InChIKey | DMOZJOAVPQBPSX-VXQWEOQQSA-O |
| XLogP | 6.03 |
| TPSA | 41.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.29 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|