C20H32N2O5 — CID 123734005
[(4S)-octa-1,5,7-trien-4-yl] 3-[2-hydroxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1-carboxylate (PubChem CID 123734005) has the molecular formula C20H32N2O5 and a molecular weight of 380.49 g/mol. Its IUPAC name is [(4S)-octa-1,5,7-trien-4-yl] 3-[2-hydroxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | [(4S)-octa-1,5,7-trien-4-yl] 3-[2-hydroxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123734005 |
| Molecular Formula | C20H32N2O5 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.23 |
| IUPAC Name | [(4S)-octa-1,5,7-trien-4-yl] 3-[2-hydroxyethyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pyrrolidine-1-carboxylate |
| SMILES | C=CC=C[C@H](CC=C)OC(=O)N1CCC(N(CCO)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C20H32N2O5/c1-6-8-10-17(9-7-2)26-18(24)21-12-11-16(15-21)22(13-14-23)19(25)27-20(3,4)5/h6-8,10,16-17,23H,1-2,9,11-15H2,3-5H3/t16?,17-/m0/s1 |
| InChIKey | PNRXBNMLRJHXFT-DJNXLDHESA-N |
| XLogP | 3.11 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|