C19H25F4N3O3S — CID 123734422
(1,1,1-trifluoro-2-methylpropan-2-yl) N-[(E)-4-[ethyl-(4-fluorophenyl)sulfonylamino]hex-3-en-2-ylidene]carbamimidate (PubChem CID 123734422) has the molecular formula C19H25F4N3O3S and a molecular weight of 451.49 g/mol. Its IUPAC name is (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(E)-4-[ethyl-(4-fluorophenyl)sulfonylamino]hex-3-en-2-ylidene]carbamimidate.
| Compound Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(E)-4-[ethyl-(4-fluorophenyl)sulfonylamino]hex-3-en-2-ylidene]carbamimidate |
|---|---|
| PubChem CID | 123734422 |
| Molecular Formula | C19H25F4N3O3S |
| Molecular Weight | 451.49 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | (1,1,1-trifluoro-2-methylpropan-2-yl) N-[(E)-4-[ethyl-(4-fluorophenyl)sulfonylamino]hex-3-en-2-ylidene]carbamimidate |
| SMILES | [H]/N=C(/N=C(C)/C=C(\CC)N(CC)S(=O)(=O)c1ccc(F)cc1)OC(C)(C)C(F)(F)F |
| InChI | InChI=1S/C19H25F4N3O3S/c1-6-15(12-13(3)25-17(24)29-18(4,5)19(21,22)23)26(7-2)30(27,28)16-10-8-14(20)9-11-16/h8-12,24H,6-7H2,1-5H3/b15-12+,24-17-,25-13? |
| InChIKey | AABPCRFISBYMMU-QFVLVWEASA-N |
| XLogP | 4.88 |
| TPSA | 82.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|