C10H22N2O2 — CID 123734761
N,N-dimethyl-1-(2-morpholin-4-ylethoxy)ethanamine (PubChem CID 123734761) has the molecular formula C10H22N2O2 and a molecular weight of 202.30 g/mol. Its IUPAC name is N,N-dimethyl-1-(2-morpholin-4-ylethoxy)ethanamine.
| Compound Name | N,N-dimethyl-1-(2-morpholin-4-ylethoxy)ethanamine |
|---|---|
| PubChem CID | 123734761 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | N,N-dimethyl-1-(2-morpholin-4-ylethoxy)ethanamine |
| SMILES | CC(OCCN1CCOCC1)N(C)C |
| InChI | InChI=1S/C10H22N2O2/c1-10(11(2)3)14-9-6-12-4-7-13-8-5-12/h10H,4-9H2,1-3H3 |
| InChIKey | IXJXKWOOOPNJSI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|