C7H11N5O — CID 123734877
6-(dimethylamino)-1,3,4,7-tetrahydropurin-2-one (PubChem CID 123734877) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is 6-(dimethylamino)-1,3,4,7-tetrahydropurin-2-one.
| Compound Name | 6-(dimethylamino)-1,3,4,7-tetrahydropurin-2-one |
|---|---|
| PubChem CID | 123734877 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 6-(dimethylamino)-1,3,4,7-tetrahydropurin-2-one |
| SMILES | CN(C)C1=C2NC=NC2NC(=O)N1 |
| InChI | InChI=1S/C7H11N5O/c1-12(2)6-4-5(9-3-8-4)10-7(13)11-6/h3,5H,1-2H3,(H,8,9)(H2,10,11,13) |
| InChIKey | JCRZYMUYGYMCOM-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |