C9H15NO — CID 123735018
4-methoxy-N,N-dimethylcyclohexa-1,3-dien-1-amine (PubChem CID 123735018) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethylcyclohexa-1,3-dien-1-amine.
| Compound Name | 4-methoxy-N,N-dimethylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 123735018 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | 4-methoxy-N,N-dimethylcyclohexa-1,3-dien-1-amine |
| SMILES | COC1=CC=C(N(C)C)CC1 |
| InChI | InChI=1S/C9H15NO/c1-10(2)8-4-6-9(11-3)7-5-8/h4,6H,5,7H2,1-3H3 |
| InChIKey | NSVLGKZRCASPBU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |