C28H28ClF4NO2 — CID 123735049
5-[2-(5-chloro-2-fluorophenyl)-5-(trifluoromethyl)phenyl]-1-(5-methylidenehept-1-en-3-yl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one (PubChem CID 123735049) has the molecular formula C28H28ClF4NO2 and a molecular weight of 521.98 g/mol. Its IUPAC name is 5-[2-(5-chloro-2-fluorophenyl)-5-(trifluoromethyl)phenyl]-1-(5-methylidenehept-1-en-3-yl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one.
| Compound Name | 5-[2-(5-chloro-2-fluorophenyl)-5-(trifluoromethyl)phenyl]-1-(5-methylidenehept-1-en-3-yl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
|---|---|
| PubChem CID | 123735049 |
| Molecular Formula | C28H28ClF4NO2 |
| Molecular Weight | 521.98 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | 5-[2-(5-chloro-2-fluorophenyl)-5-(trifluoromethyl)phenyl]-1-(5-methylidenehept-1-en-3-yl)-1,5,6,7,8,8a-hexahydro-[1,3]oxazolo[3,4-a]pyridin-3-one |
| SMILES | C=CC(CC(=C)CC)C1OC(=O)N2C(c3cc(C(F)(F)F)ccc3-c3cc(Cl)ccc3F)CCCC12 |
| InChI | InChI=1S/C28H28ClF4NO2/c1-4-16(3)13-17(5-2)26-25-8-6-7-24(34(25)27(35)36-26)22-14-18(28(31,32)33)9-11-20(22)21-15-19(29)10-12-23(21)30/h5,9-12,14-15,17,24-26H,2-4,6-8,13H2,1H3 |
| InChIKey | ACSKGWIEYPNHNX-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.98 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|