C16H14ClF2O4PS — CID 123735158
4-(3-chloro-5-fluorophenoxy)-2-fluoro-7-methylsulfonyl-2-phosphanyl-1,3-dihydroinden-1-ol (PubChem CID 123735158) has the molecular formula C16H14ClF2O4PS and a molecular weight of 406.77 g/mol. Its IUPAC name is 4-(3-chloro-5-fluorophenoxy)-2-fluoro-7-methylsulfonyl-2-phosphanyl-1,3-dihydroinden-1-ol.
| Compound Name | 4-(3-chloro-5-fluorophenoxy)-2-fluoro-7-methylsulfonyl-2-phosphanyl-1,3-dihydroinden-1-ol |
|---|---|
| PubChem CID | 123735158 |
| Molecular Formula | C16H14ClF2O4PS |
| Molecular Weight | 406.77 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 4-(3-chloro-5-fluorophenoxy)-2-fluoro-7-methylsulfonyl-2-phosphanyl-1,3-dihydroinden-1-ol |
| SMILES | CS(=O)(=O)c1ccc(Oc2cc(F)cc(Cl)c2)c2c1C(O)C(F)(P)C2 |
| InChI | InChI=1S/C16H14ClF2O4PS/c1-25(21,22)13-3-2-12(11-7-16(19,24)15(20)14(11)13)23-10-5-8(17)4-9(18)6-10/h2-6,15,20H,7,24H2,1H3 |
| InChIKey | ZHURGVCIGHMXAR-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.77 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|