C18H22ClN3O — CID 123735245
5-(6-chloro-2-pyridinyl)-1-(2,2-dimethylpropyl)-3-methyl-5,6-dihydrobenzimidazol-2-one (PubChem CID 123735245) has the molecular formula C18H22ClN3O and a molecular weight of 331.85 g/mol. Its IUPAC name is 5-(6-chloro-2-pyridinyl)-1-(2,2-dimethylpropyl)-3-methyl-5,6-dihydrobenzimidazol-2-one.
| Compound Name | 5-(6-chloro-2-pyridinyl)-1-(2,2-dimethylpropyl)-3-methyl-5,6-dihydrobenzimidazol-2-one |
|---|---|
| PubChem CID | 123735245 |
| Molecular Formula | C18H22ClN3O |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 5-(6-chloro-2-pyridinyl)-1-(2,2-dimethylpropyl)-3-methyl-5,6-dihydrobenzimidazol-2-one |
| SMILES | Cn1c2c(n(CC(C)(C)C)c1=O)=CCC(c1cccc(Cl)n1)C=2 |
| InChI | InChI=1S/C18H22ClN3O/c1-18(2,3)11-22-14-9-8-12(10-15(14)21(4)17(22)23)13-6-5-7-16(19)20-13/h5-7,9-10,12H,8,11H2,1-4H3 |
| InChIKey | RTNDRKSEBNIEBE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|