C8H17NO8P+ — CID 123735609
(5-acetamido-1,2,4,6-tetrahydroxyhexan-3-yl)oxy-hydroxy-oxophosphanium (PubChem CID 123735609) has the molecular formula C8H17NO8P+ and a molecular weight of 286.20 g/mol. Its IUPAC name is (5-acetamido-1,2,4,6-tetrahydroxyhexan-3-yl)oxy-hydroxy-oxophosphanium.
| Compound Name | (5-acetamido-1,2,4,6-tetrahydroxyhexan-3-yl)oxy-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 123735609 |
| Molecular Formula | C8H17NO8P+ |
| Molecular Weight | 286.20 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | (5-acetamido-1,2,4,6-tetrahydroxyhexan-3-yl)oxy-hydroxy-oxophosphanium |
| SMILES | CC(=O)NC(CO)C(O)C(O[P+](=O)O)C(O)CO |
| InChI | InChI=1S/C8H16NO8P/c1-4(12)9-5(2-10)7(14)8(6(13)3-11)17-18(15)16/h5-8,10-11,13-14H,2-3H2,1H3,(H-,9,12,15,16)/p+1 |
| InChIKey | ZBHDGYJTGMEPFY-UHFFFAOYSA-O |
| XLogP | -2.77 |
| TPSA | 156.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.20 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|