About nonyl-oxo-oxosilylsilane
nonyl-oxo-oxosilylsilane (PubChem CID 123735974) has the molecular formula C9H20O2Si2
and a molecular weight of 216.43 g/mol. Its IUPAC name is nonyl-oxo-oxosilylsilane.
Molecular Properties
| Compound Name | nonyl-oxo-oxosilylsilane |
| PubChem CID | 123735974 |
| Molecular Formula | C9H20O2Si2 |
| Molecular Weight | 216.43 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | nonyl-oxo-oxosilylsilane |
| SMILES | CCCCCCCCC[Si](=O)[SiH]=O |
| InChI | InChI=1S/C9H20O2Si2/c1-2-3-4-5-6-7-8-9-13(11)12-10/h12H,2-9H2,1H3 |
| InChIKey | UITPXFPJCPSIST-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze nonyl-oxo-oxosilylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonyl-oxo-oxosilylsilane?
The IUPAC name of nonyl-oxo-oxosilylsilane (CID 123735974) is nonyl-oxo-oxosilylsilane.
What is the SMILES notation for nonyl-oxo-oxosilylsilane?
The canonical SMILES for nonyl-oxo-oxosilylsilane is CCCCCCCCC[Si](=O)[SiH]=O.
What is the InChIKey of nonyl-oxo-oxosilylsilane?
The InChIKey is UITPXFPJCPSIST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2Si2/c1-2-3-4-5-6-7-8-9-13(11)12-10/h12H,2-9H2,1H3.
What are the key properties of nonyl-oxo-oxosilylsilane?
nonyl-oxo-oxosilylsilane has a molecular weight of 216.43 g/mol, XLogP of 2.44, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nonyl-oxo-oxosilylsilane is sourced from PubChem (CID 123735974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).