C30H27Cl2N7O3 — CID 123736253
1-[3-[4-amino-3-[4-(3,4-dichlorophenoxy)-3-methoxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one (PubChem CID 123736253) has the molecular formula C30H27Cl2N7O3 and a molecular weight of 604.50 g/mol. Its IUPAC name is 1-[3-[4-amino-3-[4-(3,4-dichlorophenoxy)-3-methoxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-3-[4-(3,4-dichlorophenoxy)-3-methoxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one |
|---|---|
| PubChem CID | 123736253 |
| Molecular Formula | C30H27Cl2N7O3 |
| Molecular Weight | 604.50 g/mol |
| Exact Mass | 603.16 |
| IUPAC Name | 1-[3-[4-amino-3-[4-(3,4-dichlorophenoxy)-3-methoxyphenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]-3-cyclopropyl-2-isocyanoprop-2-en-1-one |
| SMILES | [C-]#[N+]C(=CC1CC1)C(=O)N1CCCC(n2nc(-c3ccc(Oc4ccc(Cl)c(Cl)c4)c(OC)c3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C30H27Cl2N7O3/c1-34-23(12-17-5-6-17)30(40)38-11-3-4-19(15-38)39-29-26(28(33)35-16-36-29)27(37-39)18-7-10-24(25(13-18)41-2)42-20-8-9-21(31)22(32)14-20/h7-10,12-14,16-17,19H,3-6,11,15H2,2H3,(H2,33,35,36) |
| InChIKey | ZQLRVYLQKASLEK-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 112.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.50 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|