About 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol
1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol (PubChem CID 123736657) has the molecular formula C10H20F3NO3S
and a molecular weight of 291.34 g/mol. Its IUPAC name is 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol.
Molecular Properties
| Compound Name | 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol |
| PubChem CID | 123736657 |
| Molecular Formula | C10H20F3NO3S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol |
| SMILES | CCC(O)CNCCCS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO3S/c1-2-9(15)8-14-5-3-6-18(16,17)7-4-10(11,12)13/h9,14-15H,2-8H2,1H3 |
| InChIKey | UNZWCRGGUQZJJG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol?
The IUPAC name of 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol (CID 123736657) is 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol.
What is the SMILES notation for 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol?
The canonical SMILES for 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol is CCC(O)CNCCCS(=O)(=O)CCC(F)(F)F.
What is the InChIKey of 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol?
The InChIKey is UNZWCRGGUQZJJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20F3NO3S/c1-2-9(15)8-14-5-3-6-18(16,17)7-4-10(11,12)13/h9,14-15H,2-8H2,1H3.
What are the key properties of 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol?
1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol has a molecular weight of 291.34 g/mol, XLogP of 1.10, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3,3,3-trifluoropropylsulfonyl)propylamino]butan-2-ol is sourced from PubChem (CID 123736657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).